C14H25NO2S — CID 64691840
4-tert-butyl-2-propan-2-ylsulfonylcyclohexane-1-carbonitrile (PubChem CID 64691840) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is 4-tert-butyl-2-propan-2-ylsulfonylcyclohexane-1-carbonitrile.
| Compound Name | 4-tert-butyl-2-propan-2-ylsulfonylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64691840 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 4-tert-butyl-2-propan-2-ylsulfonylcyclohexane-1-carbonitrile |
| SMILES | CC(C)S(=O)(=O)C1CC(C(C)(C)C)CCC1C#N |
| InChI | InChI=1S/C14H25NO2S/c1-10(2)18(16,17)13-8-12(14(3,4)5)7-6-11(13)9-15/h10-13H,6-8H2,1-5H3 |
| InChIKey | LJVWFLYTTHBDOI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |