C16H33NO2S — CID 64674025
N-ethyl-4-(2-methylbutan-2-yl)-2-propan-2-ylsulfonylcyclohexan-1-amine (PubChem CID 64674025) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is N-ethyl-4-(2-methylbutan-2-yl)-2-propan-2-ylsulfonylcyclohexan-1-amine.
| Compound Name | N-ethyl-4-(2-methylbutan-2-yl)-2-propan-2-ylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64674025 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-ethyl-4-(2-methylbutan-2-yl)-2-propan-2-ylsulfonylcyclohexan-1-amine |
| SMILES | CCNC1CCC(C(C)(C)CC)CC1S(=O)(=O)C(C)C |
| InChI | InChI=1S/C16H33NO2S/c1-7-16(5,6)13-9-10-14(17-8-2)15(11-13)20(18,19)12(3)4/h12-15,17H,7-11H2,1-6H3 |
| InChIKey | SWCQLYJHOYZPKS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |