C14H29NO2S — CID 64696759
[2-ethylsulfonyl-4-(2-methylbutan-2-yl)cyclohexyl]methanamine (PubChem CID 64696759) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is [2-ethylsulfonyl-4-(2-methylbutan-2-yl)cyclohexyl]methanamine.
| Compound Name | [2-ethylsulfonyl-4-(2-methylbutan-2-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 64696759 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [2-ethylsulfonyl-4-(2-methylbutan-2-yl)cyclohexyl]methanamine |
| SMILES | CCC(C)(C)C1CCC(CN)C(S(=O)(=O)CC)C1 |
| InChI | InChI=1S/C14H29NO2S/c1-5-14(3,4)12-8-7-11(10-15)13(9-12)18(16,17)6-2/h11-13H,5-10,15H2,1-4H3 |
| InChIKey | CQRIAEJWMYDVAY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |