C6H13NO2S — CID 99990768
[(1S,2S)-2-ethylsulfonylcyclopropyl]methanamine (PubChem CID 99990768) has the molecular formula C6H13NO2S and a molecular weight of 163.24 g/mol. Its IUPAC name is [(1S,2S)-2-ethylsulfonylcyclopropyl]methanamine.
| Compound Name | [(1S,2S)-2-ethylsulfonylcyclopropyl]methanamine |
|---|---|
| PubChem CID | 99990768 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | [(1S,2S)-2-ethylsulfonylcyclopropyl]methanamine |
| SMILES | CCS(=O)(=O)[C@H]1C[C@H]1CN |
| InChI | InChI=1S/C6H13NO2S/c1-2-10(8,9)6-3-5(6)4-7/h5-6H,2-4,7H2,1H3/t5-,6-/m0/s1 |
| InChIKey | OSOLPHVUQUKNHU-WDSKDSINSA-N |
| XLogP | -0.23 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |