C6H10O3S — CID 99990748
cis-(1R,2S)-2-ethylsulfonylcyclopropane-1-carbaldehyde (PubChem CID 99990748) has the molecular formula C6H10O3S and a molecular weight of 162.21 g/mol. Its IUPAC name is cis-(1R,2S)-2-ethylsulfonylcyclopropane-1-carbaldehyde.
| Compound Name | cis-(1R,2S)-2-ethylsulfonylcyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 99990748 |
| Molecular Formula | C6H10O3S |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | cis-(1R,2S)-2-ethylsulfonylcyclopropane-1-carbaldehyde |
| SMILES | CCS(=O)(=O)[C@H]1C[C@@H]1C=O |
| InChI | InChI=1S/C6H10O3S/c1-2-10(8,9)6-3-5(6)4-7/h4-6H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | HLHPJPISQCWUDG-RITPCOANSA-N |
| XLogP | 0.01 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|