C9H16O — CID 125425466
cis-(1R,2S)-2-[(2S)-pentan-2-yl]cyclopropane-1-carbaldehyde (PubChem CID 125425466) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is cis-(1R,2S)-2-[(2S)-pentan-2-yl]cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1R,2S)-2-[(2S)-pentan-2-yl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 125425466 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | cis-(1R,2S)-2-[(2S)-pentan-2-yl]cyclopropane-1-carbaldehyde |
| SMILES | CCC[C@H](C)[C@@H]1C[C@H]1C=O |
| InChI | InChI=1S/C9H16O/c1-3-4-7(2)9-5-8(9)6-10/h6-9H,3-5H2,1-2H3/t7-,8-,9-/m0/s1 |
| InChIKey | HIZSMNGBBXFCKE-CIUDSAMLSA-N |
| XLogP | 2.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|