C15H27NO3S — CID 64691011
2-(2-methoxyethylsulfonyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile (PubChem CID 64691011) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is 2-(2-methoxyethylsulfonyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile.
| Compound Name | 2-(2-methoxyethylsulfonyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64691011 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2-(2-methoxyethylsulfonyl)-4-(2-methylbutan-2-yl)cyclohexane-1-carbonitrile |
| SMILES | CCC(C)(C)C1CCC(C#N)C(S(=O)(=O)CCOC)C1 |
| InChI | InChI=1S/C15H27NO3S/c1-5-15(2,3)13-7-6-12(11-16)14(10-13)20(17,18)9-8-19-4/h12-14H,5-10H2,1-4H3 |
| InChIKey | DPTSRSODGINUME-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |