C16H27NOS2 — CID 81328942
[4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfinylcyclohexyl]methanamine (PubChem CID 81328942) has the molecular formula C16H27NOS2 and a molecular weight of 313.53 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfinylcyclohexyl]methanamine.
| Compound Name | [4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfinylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81328942 |
| Molecular Formula | C16H27NOS2 |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [4-(2-methylbutan-2-yl)-2-thiophen-2-ylsulfinylcyclohexyl]methanamine |
| SMILES | CCC(C)(C)C1CCC(CN)C(S(=O)c2cccs2)C1 |
| InChI | InChI=1S/C16H27NOS2/c1-4-16(2,3)13-8-7-12(11-17)14(10-13)20(18)15-6-5-9-19-15/h5-6,9,12-14H,4,7-8,10-11,17H2,1-3H3 |
| InChIKey | XWDNBAGYGODUOQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |