C12H19NOS2 — CID 81328024
(2-thiophen-2-ylsulfinylcycloheptyl)methanamine (PubChem CID 81328024) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is (2-thiophen-2-ylsulfinylcycloheptyl)methanamine.
| Compound Name | (2-thiophen-2-ylsulfinylcycloheptyl)methanamine |
|---|---|
| PubChem CID | 81328024 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2-thiophen-2-ylsulfinylcycloheptyl)methanamine |
| SMILES | NCC1CCCCCC1S(=O)c1cccs1 |
| InChI | InChI=1S/C12H19NOS2/c13-9-10-5-2-1-3-6-11(10)16(14)12-7-4-8-15-12/h4,7-8,10-11H,1-3,5-6,9,13H2 |
| InChIKey | JKFCMRRRNPQIPQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |