C14H23NOS2 — CID 81328241
(4-propyl-2-thiophen-2-ylsulfinylcyclohexyl)methanamine (PubChem CID 81328241) has the molecular formula C14H23NOS2 and a molecular weight of 285.48 g/mol. Its IUPAC name is (4-propyl-2-thiophen-2-ylsulfinylcyclohexyl)methanamine.
| Compound Name | (4-propyl-2-thiophen-2-ylsulfinylcyclohexyl)methanamine |
|---|---|
| PubChem CID | 81328241 |
| Molecular Formula | C14H23NOS2 |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (4-propyl-2-thiophen-2-ylsulfinylcyclohexyl)methanamine |
| SMILES | CCCC1CCC(CN)C(S(=O)c2cccs2)C1 |
| InChI | InChI=1S/C14H23NOS2/c1-2-4-11-6-7-12(10-15)13(9-11)18(16)14-5-3-8-17-14/h3,5,8,11-13H,2,4,6-7,9-10,15H2,1H3 |
| InChIKey | PCJRHCTYMZTRLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |