C17H33NO3 — CID 106499621
4-[(2,2-dimethylheptylamino)methyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106499621) has the molecular formula C17H33NO3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 4-[(2,2-dimethylheptylamino)methyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2,2-dimethylheptylamino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106499621 |
| Molecular Formula | C17H33NO3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.25 |
| IUPAC Name | 4-[(2,2-dimethylheptylamino)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | CCCCCC(C)(C)CNCC1(O)CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C17H33NO3/c1-4-5-6-9-16(2,3)12-18-13-17(21)10-7-14(8-11-17)15(19)20/h14,18,21H,4-13H2,1-3H3,(H,19,20) |
| InChIKey | YQPVAFBMVGRHBH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|