C27H31NO3Sn — CID 10650030
tert-butyl 4-benzoyl-3-[(E)-2-phenylethenyl]-2-trimethylstannylpyrrole-1-carboxylate (PubChem CID 10650030) has the molecular formula C27H31NO3Sn and a molecular weight of 536.26 g/mol. Its IUPAC name is tert-butyl 4-benzoyl-3-[(E)-2-phenylethenyl]-2-trimethylstannylpyrrole-1-carboxylate.
| Compound Name | tert-butyl 4-benzoyl-3-[(E)-2-phenylethenyl]-2-trimethylstannylpyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10650030 |
| Molecular Formula | C27H31NO3Sn |
| Molecular Weight | 536.26 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | tert-butyl 4-benzoyl-3-[(E)-2-phenylethenyl]-2-trimethylstannylpyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(=O)c2ccccc2)c(/C=C/c2ccccc2)c1[Sn](C)(C)C |
| InChI | InChI=1S/C24H22NO3.3CH3.Sn/c1-24(2,3)28-23(27)25-16-20(15-14-18-10-6-4-7-11-18)21(17-25)22(26)19-12-8-5-9-13-19;;;;/h4-15,17H,1-3H3;3*1H3;/b15-14+;;;; |
| InChIKey | CTGMNDPCWZMUBG-YRWWQZRJSA-N |
| XLogP | 6.22 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.26 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |