C15H19ClN2O2 — CID 106501584
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-chloro-5-hydroxybenzamide (PubChem CID 106501584) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-chloro-5-hydroxybenzamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-chloro-5-hydroxybenzamide |
|---|---|
| PubChem CID | 106501584 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-2-chloro-5-hydroxybenzamide |
| SMILES | O=C(NC1CCN2CCCCC12)c1cc(O)ccc1Cl |
| InChI | InChI=1S/C15H19ClN2O2/c16-12-5-4-10(19)9-11(12)15(20)17-13-6-8-18-7-2-1-3-14(13)18/h4-5,9,13-14,19H,1-3,6-8H2,(H,17,20) |
| InChIKey | NFYSJWTZDJQNDI-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |