C29H41NO9Si — CID 10650815
methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-4-hydroxy-2-methoxyoxane-2-carboxylate (PubChem CID 10650815) has the molecular formula C29H41NO9Si and a molecular weight of 575.73 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-4-hydroxy-2-methoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-4-hydroxy-2-methoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 10650815 |
| Molecular Formula | C29H41NO9Si |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-6-[(1R,2R)-3-[tert-butyl(diphenyl)silyl]oxy-1,2-dihydroxypropyl]-4-hydroxy-2-methoxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H41NO9Si/c1-19(31)30-24-22(32)17-29(37-6,27(35)36-5)39-26(24)25(34)23(33)18-38-40(28(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22-26,32-34H,17-18H2,1-6H3,(H,30,31)/t22-,23+,24+,25+,26+,29-/m0/s1 |
| InChIKey | CWVFCTVYHYCALE-OETXPTNLSA-N |
| XLogP | 0.46 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|