C14H21NO3 — CID 106509046
methyl 2-(aminomethyl)-5-hydroxy-2-(2-methylphenyl)pentanoate (PubChem CID 106509046) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 2-(aminomethyl)-5-hydroxy-2-(2-methylphenyl)pentanoate.
| Compound Name | methyl 2-(aminomethyl)-5-hydroxy-2-(2-methylphenyl)pentanoate |
|---|---|
| PubChem CID | 106509046 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl 2-(aminomethyl)-5-hydroxy-2-(2-methylphenyl)pentanoate |
| SMILES | COC(=O)C(CN)(CCCO)c1ccccc1C |
| InChI | InChI=1S/C14H21NO3/c1-11-6-3-4-7-12(11)14(10-15,8-5-9-16)13(17)18-2/h3-4,6-7,16H,5,8-10,15H2,1-2H3 |
| InChIKey | SGCBYVUNQASTSK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |