C17H20F2N2 — CID 106511356
N'-benzyl-N'-[1-(3,5-difluorophenyl)ethyl]ethane-1,2-diamine (PubChem CID 106511356) has the molecular formula C17H20F2N2 and a molecular weight of 290.36 g/mol. Its IUPAC name is N'-benzyl-N'-[1-(3,5-difluorophenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N'-benzyl-N'-[1-(3,5-difluorophenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 106511356 |
| Molecular Formula | C17H20F2N2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N'-benzyl-N'-[1-(3,5-difluorophenyl)ethyl]ethane-1,2-diamine |
| SMILES | CC(c1cc(F)cc(F)c1)N(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C17H20F2N2/c1-13(15-9-16(18)11-17(19)10-15)21(8-7-20)12-14-5-3-2-4-6-14/h2-6,9-11,13H,7-8,12,20H2,1H3 |
| InChIKey | RRKRSBGLUFCASH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |