C12H9F3N2OS — CID 106514804
5-methyl-6-[2-(trifluoromethoxy)phenyl]-1H-pyrimidine-2-thione (PubChem CID 106514804) has the molecular formula C12H9F3N2OS and a molecular weight of 286.28 g/mol. Its IUPAC name is 5-methyl-6-[2-(trifluoromethoxy)phenyl]-1H-pyrimidine-2-thione.
| Compound Name | 5-methyl-6-[2-(trifluoromethoxy)phenyl]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 106514804 |
| Molecular Formula | C12H9F3N2OS |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 5-methyl-6-[2-(trifluoromethoxy)phenyl]-1H-pyrimidine-2-thione |
| SMILES | Cc1cnc(=S)[nH]c1-c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C12H9F3N2OS/c1-7-6-16-11(19)17-10(7)8-4-2-3-5-9(8)18-12(13,14)15/h2-6H,1H3,(H,16,17,19) |
| InChIKey | PHZKXKPHDSBPGY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|