C11H9F3N2O2 — CID 63108258
[2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-5-yl]methanol (PubChem CID 63108258) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is [2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-5-yl]methanol.
| Compound Name | [2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-5-yl]methanol |
|---|---|
| PubChem CID | 63108258 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | [2-[2-(trifluoromethoxy)phenyl]-1H-imidazol-5-yl]methanol |
| SMILES | OCc1cnc(-c2ccccc2OC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H9F3N2O2/c12-11(13,14)18-9-4-2-1-3-8(9)10-15-5-7(6-17)16-10/h1-5,17H,6H2,(H,15,16) |
| InChIKey | FRPQGZUNYOUAOD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |