C10H8F3N3O — CID 106515833
6-(1-methylpyrazol-4-yl)-4-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 106515833) has the molecular formula C10H8F3N3O and a molecular weight of 243.19 g/mol. Its IUPAC name is 6-(1-methylpyrazol-4-yl)-4-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 6-(1-methylpyrazol-4-yl)-4-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 106515833 |
| Molecular Formula | C10H8F3N3O |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 6-(1-methylpyrazol-4-yl)-4-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | Cn1cc(-c2cc(C(F)(F)F)cc(=O)[nH]2)cn1 |
| InChI | InChI=1S/C10H8F3N3O/c1-16-5-6(4-14-16)8-2-7(10(11,12)13)3-9(17)15-8/h2-5H,1H3,(H,15,17) |
| InChIKey | IKZKVGOMLANQKI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |