C11H7N3S2 — CID 106519659
5-quinolin-8-yl-3H-1,3,4-thiadiazole-2-thione (PubChem CID 106519659) has the molecular formula C11H7N3S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-quinolin-8-yl-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-quinolin-8-yl-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 106519659 |
| Molecular Formula | C11H7N3S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 5-quinolin-8-yl-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cccc3cccnc23)s1 |
| InChI | InChI=1S/C11H7N3S2/c15-11-14-13-10(16-11)8-5-1-3-7-4-2-6-12-9(7)8/h1-6H,(H,14,15) |
| InChIKey | JIHLRDTUNRJNMX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|