C15H18N2OS — CID 106520354
2-(methoxymethyl)-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106520354) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-(methoxymethyl)-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106520354 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(methoxymethyl)-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione |
| SMILES | COCc1nc(=S)cc(-c2c(C)cc(C)cc2C)[nH]1 |
| InChI | InChI=1S/C15H18N2OS/c1-9-5-10(2)15(11(3)6-9)12-7-14(19)17-13(16-12)8-18-4/h5-7H,8H2,1-4H3,(H,16,17,19) |
| InChIKey | YPPMBSIXNSSNRH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|