C16H18N2S — CID 106520335
2-cyclopropyl-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106520335) has the molecular formula C16H18N2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-cyclopropyl-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106520335 |
| Molecular Formula | C16H18N2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-cyclopropyl-6-(2,4,6-trimethylphenyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(C)c(-c2cc(=S)nc(C3CC3)[nH]2)c(C)c1 |
| InChI | InChI=1S/C16H18N2S/c1-9-6-10(2)15(11(3)7-9)13-8-14(19)18-16(17-13)12-4-5-12/h6-8,12H,4-5H2,1-3H3,(H,17,18,19) |
| InChIKey | WDTJXIRSDDPPLM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|