C17H20N2S — CID 106474873
2-(4-methylcyclohexyl)-6-phenyl-1H-pyrimidine-4-thione (PubChem CID 106474873) has the molecular formula C17H20N2S and a molecular weight of 284.43 g/mol. Its IUPAC name is 2-(4-methylcyclohexyl)-6-phenyl-1H-pyrimidine-4-thione.
| Compound Name | 2-(4-methylcyclohexyl)-6-phenyl-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106474873 |
| Molecular Formula | C17H20N2S |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-(4-methylcyclohexyl)-6-phenyl-1H-pyrimidine-4-thione |
| SMILES | CC1CCC(c2nc(=S)cc(-c3ccccc3)[nH]2)CC1 |
| InChI | InChI=1S/C17H20N2S/c1-12-7-9-14(10-8-12)17-18-15(11-16(20)19-17)13-5-3-2-4-6-13/h2-6,11-12,14H,7-10H2,1H3,(H,18,19,20) |
| InChIKey | KWMAERQTAITHSD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|