C12H10FN3S — CID 106515800
2-cyclopropyl-6-(5-fluoro-3-pyridinyl)-1H-pyrimidine-4-thione (PubChem CID 106515800) has the molecular formula C12H10FN3S and a molecular weight of 247.30 g/mol. Its IUPAC name is 2-cyclopropyl-6-(5-fluoro-3-pyridinyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-cyclopropyl-6-(5-fluoro-3-pyridinyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106515800 |
| Molecular Formula | C12H10FN3S |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-cyclopropyl-6-(5-fluoro-3-pyridinyl)-1H-pyrimidine-4-thione |
| SMILES | Fc1cncc(-c2cc(=S)nc(C3CC3)[nH]2)c1 |
| InChI | InChI=1S/C12H10FN3S/c13-9-3-8(5-14-6-9)10-4-11(17)16-12(15-10)7-1-2-7/h3-7H,1-2H2,(H,15,16,17) |
| InChIKey | LFVRWNPPCAORPI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|