C12H9F2NO — CID 106520830
2-(2,6-difluoro-3-methylphenyl)-1H-pyridin-4-one (PubChem CID 106520830) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(2,6-difluoro-3-methylphenyl)-1H-pyridin-4-one.
| Compound Name | 2-(2,6-difluoro-3-methylphenyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 106520830 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(2,6-difluoro-3-methylphenyl)-1H-pyridin-4-one |
| SMILES | Cc1ccc(F)c(-c2cc(=O)cc[nH]2)c1F |
| InChI | InChI=1S/C12H9F2NO/c1-7-2-3-9(13)11(12(7)14)10-6-8(16)4-5-15-10/h2-6H,1H3,(H,15,16) |
| InChIKey | GOCTWAVOZQVDGO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |