C15H16F2N2S — CID 106520877
2-tert-butyl-6-(2,6-difluoro-3-methylphenyl)-1H-pyrimidine-4-thione (PubChem CID 106520877) has the molecular formula C15H16F2N2S and a molecular weight of 294.37 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,6-difluoro-3-methylphenyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-tert-butyl-6-(2,6-difluoro-3-methylphenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106520877 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-tert-butyl-6-(2,6-difluoro-3-methylphenyl)-1H-pyrimidine-4-thione |
| SMILES | Cc1ccc(F)c(-c2cc(=S)nc(C(C)(C)C)[nH]2)c1F |
| InChI | InChI=1S/C15H16F2N2S/c1-8-5-6-9(16)12(13(8)17)10-7-11(20)19-14(18-10)15(2,3)4/h5-7H,1-4H3,(H,18,19,20) |
| InChIKey | CUMSESJEHWOZBC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|