C15H18N2OS — CID 106521275
3-(4-methoxy-2,5-dimethylphenyl)-5,6-dimethyl-1H-pyrazine-2-thione (PubChem CID 106521275) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 3-(4-methoxy-2,5-dimethylphenyl)-5,6-dimethyl-1H-pyrazine-2-thione.
| Compound Name | 3-(4-methoxy-2,5-dimethylphenyl)-5,6-dimethyl-1H-pyrazine-2-thione |
|---|---|
| PubChem CID | 106521275 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-(4-methoxy-2,5-dimethylphenyl)-5,6-dimethyl-1H-pyrazine-2-thione |
| SMILES | COc1cc(C)c(-c2nc(C)c(C)[nH]c2=S)cc1C |
| InChI | InChI=1S/C15H18N2OS/c1-8-7-13(18-5)9(2)6-12(8)14-15(19)17-11(4)10(3)16-14/h6-7H,1-5H3,(H,17,19) |
| InChIKey | NOIKNILDQZJPJD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|