C11H10N2O2S2 — CID 106522822
methyl 4-methyl-3-(2-sulfanylidene-1H-pyrazin-3-yl)thiophene-2-carboxylate (PubChem CID 106522822) has the molecular formula C11H10N2O2S2 and a molecular weight of 266.35 g/mol. Its IUPAC name is methyl 4-methyl-3-(2-sulfanylidene-1H-pyrazin-3-yl)thiophene-2-carboxylate.
| Compound Name | methyl 4-methyl-3-(2-sulfanylidene-1H-pyrazin-3-yl)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 106522822 |
| Molecular Formula | C11H10N2O2S2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | methyl 4-methyl-3-(2-sulfanylidene-1H-pyrazin-3-yl)thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1-c1ncc[nH]c1=S |
| InChI | InChI=1S/C11H10N2O2S2/c1-6-5-17-9(11(14)15-2)7(6)8-10(16)13-4-3-12-8/h3-5H,1-2H3,(H,13,16) |
| InChIKey | HSELFIDFAZGPCK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|