C11H11N3O3S2 — CID 106522819
methyl 3-(6-methoxy-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-methylthiophene-2-carboxylate (PubChem CID 106522819) has the molecular formula C11H11N3O3S2 and a molecular weight of 297.36 g/mol. Its IUPAC name is methyl 3-(6-methoxy-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-methylthiophene-2-carboxylate.
| Compound Name | methyl 3-(6-methoxy-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 106522819 |
| Molecular Formula | C11H11N3O3S2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | methyl 3-(6-methoxy-4-sulfanylidene-1H-1,3,5-triazin-2-yl)-4-methylthiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1-c1nc(=S)nc(OC)[nH]1 |
| InChI | InChI=1S/C11H11N3O3S2/c1-5-4-19-7(9(15)16-2)6(5)8-12-10(17-3)14-11(18)13-8/h4H,1-3H3,(H,12,13,14,18) |
| InChIKey | PMCHCVBBZZEAMS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|