C8H7N5OS — CID 106516252
2-methoxy-6-pyrimidin-5-yl-1H-1,3,5-triazine-4-thione (PubChem CID 106516252) has the molecular formula C8H7N5OS and a molecular weight of 221.25 g/mol. Its IUPAC name is 2-methoxy-6-pyrimidin-5-yl-1H-1,3,5-triazine-4-thione.
| Compound Name | 2-methoxy-6-pyrimidin-5-yl-1H-1,3,5-triazine-4-thione |
|---|---|
| PubChem CID | 106516252 |
| Molecular Formula | C8H7N5OS |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-methoxy-6-pyrimidin-5-yl-1H-1,3,5-triazine-4-thione |
| SMILES | COc1nc(=S)nc(-c2cncnc2)[nH]1 |
| InChI | InChI=1S/C8H7N5OS/c1-14-7-11-6(12-8(15)13-7)5-2-9-4-10-3-5/h2-4H,1H3,(H,11,12,13,15) |
| InChIKey | QRZFJAGUOPIWEI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|