C12H7N5OS — CID 106523219
4-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)imidazol-1-yl]benzonitrile (PubChem CID 106523219) has the molecular formula C12H7N5OS and a molecular weight of 269.29 g/mol. Its IUPAC name is 4-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)imidazol-1-yl]benzonitrile.
| Compound Name | 4-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)imidazol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 106523219 |
| Molecular Formula | C12H7N5OS |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 4-[4-(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)imidazol-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(-n2cnc(-c3n[nH]c(=S)o3)c2)cc1 |
| InChI | InChI=1S/C12H7N5OS/c13-5-8-1-3-9(4-2-8)17-6-10(14-7-17)11-15-16-12(19)18-11/h1-4,6-7H,(H,16,19) |
| InChIKey | QDANSTYPXJHLDN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|