C8H10F3NO2 — CID 106523367
methyl 3,3,3-trifluoro-2-methyl-2-(prop-2-ynylamino)propanoate (PubChem CID 106523367) has the molecular formula C8H10F3NO2 and a molecular weight of 209.17 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-methyl-2-(prop-2-ynylamino)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-methyl-2-(prop-2-ynylamino)propanoate |
|---|---|
| PubChem CID | 106523367 |
| Molecular Formula | C8H10F3NO2 |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-methyl-2-(prop-2-ynylamino)propanoate |
| SMILES | C#CCNC(C)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO2/c1-4-5-12-7(2,6(13)14-3)8(9,10)11/h1,12H,5H2,2-3H3 |
| InChIKey | LBMCGGYESDVVEK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|