C13H19F2N3O2S — CID 106528646
2-(3,5-difluorophenyl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine (PubChem CID 106528646) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine.
| Compound Name | 2-(3,5-difluorophenyl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 106528646 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-(3,5-difluorophenyl)-2-(4-methylsulfonylpiperazin-1-yl)ethanamine |
| SMILES | CS(=O)(=O)N1CCN(C(CN)c2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C13H19F2N3O2S/c1-21(19,20)18-4-2-17(3-5-18)13(9-16)10-6-11(14)8-12(15)7-10/h6-8,13H,2-5,9,16H2,1H3 |
| InChIKey | WMKQAEYAHVNIMT-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |