C12H19FN2 — CID 106530783
3-fluoro-N-methyl-5-(methylaminomethyl)-N-propylaniline (PubChem CID 106530783) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-fluoro-N-methyl-5-(methylaminomethyl)-N-propylaniline.
| Compound Name | 3-fluoro-N-methyl-5-(methylaminomethyl)-N-propylaniline |
|---|---|
| PubChem CID | 106530783 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 3-fluoro-N-methyl-5-(methylaminomethyl)-N-propylaniline |
| SMILES | CCCN(C)c1cc(F)cc(CNC)c1 |
| InChI | InChI=1S/C12H19FN2/c1-4-5-15(3)12-7-10(9-14-2)6-11(13)8-12/h6-8,14H,4-5,9H2,1-3H3 |
| InChIKey | SRQYOOIQOHQBDF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |