C17H16FNO2 — CID 106531508
(E)-3-[3-(N,3-dimethylanilino)-5-fluorophenyl]prop-2-enoic acid (PubChem CID 106531508) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is (E)-3-[3-(N,3-dimethylanilino)-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(N,3-dimethylanilino)-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106531508 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (E)-3-[3-(N,3-dimethylanilino)-5-fluorophenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(N(C)c2cc(F)cc(/C=C/C(=O)O)c2)c1 |
| InChI | InChI=1S/C17H16FNO2/c1-12-4-3-5-15(8-12)19(2)16-10-13(6-7-17(20)21)9-14(18)11-16/h3-11H,1-2H3,(H,20,21)/b7-6+ |
| InChIKey | LVQYNKILISQGCM-VOTSOKGWSA-N |
| XLogP | 4.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|