C14H17FN2O3 — CID 106916906
(E)-3-[3-fluoro-5-[methyl-[3-(methylamino)-3-oxopropyl]amino]phenyl]prop-2-enoic acid (PubChem CID 106916906) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is (E)-3-[3-fluoro-5-[methyl-[3-(methylamino)-3-oxopropyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-fluoro-5-[methyl-[3-(methylamino)-3-oxopropyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106916906 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (E)-3-[3-fluoro-5-[methyl-[3-(methylamino)-3-oxopropyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CNC(=O)CCN(C)c1cc(F)cc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C14H17FN2O3/c1-16-13(18)5-6-17(2)12-8-10(3-4-14(19)20)7-11(15)9-12/h3-4,7-9H,5-6H2,1-2H3,(H,16,18)(H,19,20)/b4-3+ |
| InChIKey | ZZWPFATUDJEYJI-ONEGZZNKSA-N |
| XLogP | 1.50 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|