C16H25FN2O — CID 106532067
N-[[3-(2,6-dimethylmorpholin-4-yl)-5-fluorophenyl]methyl]propan-1-amine (PubChem CID 106532067) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is N-[[3-(2,6-dimethylmorpholin-4-yl)-5-fluorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-(2,6-dimethylmorpholin-4-yl)-5-fluorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106532067 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | N-[[3-(2,6-dimethylmorpholin-4-yl)-5-fluorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)cc(N2CC(C)OC(C)C2)c1 |
| InChI | InChI=1S/C16H25FN2O/c1-4-5-18-9-14-6-15(17)8-16(7-14)19-10-12(2)20-13(3)11-19/h6-8,12-13,18H,4-5,9-11H2,1-3H3 |
| InChIKey | WWTZESJKDHSMKE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|