C14H21FN2OS — CID 106532578
N-[[3-fluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-1-amine (PubChem CID 106532578) has the molecular formula C14H21FN2OS and a molecular weight of 284.40 g/mol. Its IUPAC name is N-[[3-fluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[3-fluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106532578 |
| Molecular Formula | C14H21FN2OS |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[[3-fluoro-5-(1-oxo-1,4-thiazinan-4-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)cc(N2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C14H21FN2OS/c1-2-3-16-11-12-8-13(15)10-14(9-12)17-4-6-19(18)7-5-17/h8-10,16H,2-7,11H2,1H3 |
| InChIKey | WJMNMPFUYXYSND-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|