C13H20ClN3OS — CID 62293345
N-[[5-chloro-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 62293345) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is N-[[5-chloro-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[5-chloro-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62293345 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[[5-chloro-6-(1-oxo-1,4-thiazinan-4-yl)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CCS(=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClN3OS/c1-2-3-15-9-11-8-12(14)13(16-10-11)17-4-6-19(18)7-5-17/h8,10,15H,2-7,9H2,1H3 |
| InChIKey | FVRSWMFKACGXID-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|