C15H14F3NO — CID 106533262
N-[[3-(2,4-difluorophenoxy)-5-fluorophenyl]methyl]ethanamine (PubChem CID 106533262) has the molecular formula C15H14F3NO and a molecular weight of 281.28 g/mol. Its IUPAC name is N-[[3-(2,4-difluorophenoxy)-5-fluorophenyl]methyl]ethanamine.
| Compound Name | N-[[3-(2,4-difluorophenoxy)-5-fluorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106533262 |
| Molecular Formula | C15H14F3NO |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[[3-(2,4-difluorophenoxy)-5-fluorophenyl]methyl]ethanamine |
| SMILES | CCNCc1cc(F)cc(Oc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H14F3NO/c1-2-19-9-10-5-12(17)7-13(6-10)20-15-4-3-11(16)8-14(15)18/h3-8,19H,2,9H2,1H3 |
| InChIKey | BZBSAWXNCBUEFV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |