C14H20FNS — CID 106533935
N-[(3-butan-2-ylsulfanyl-5-fluorophenyl)methyl]cyclopropanamine (PubChem CID 106533935) has the molecular formula C14H20FNS and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(3-butan-2-ylsulfanyl-5-fluorophenyl)methyl]cyclopropanamine.
| Compound Name | N-[(3-butan-2-ylsulfanyl-5-fluorophenyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106533935 |
| Molecular Formula | C14H20FNS |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-[(3-butan-2-ylsulfanyl-5-fluorophenyl)methyl]cyclopropanamine |
| SMILES | CCC(C)Sc1cc(F)cc(CNC2CC2)c1 |
| InChI | InChI=1S/C14H20FNS/c1-3-10(2)17-14-7-11(6-12(15)8-14)9-16-13-4-5-13/h6-8,10,13,16H,3-5,9H2,1-2H3 |
| InChIKey | LCODYVOJAJUWIQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |