C15H22FNO3S — CID 106722555
N-[[3-fluoro-5-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]cyclopropanamine (PubChem CID 106722555) has the molecular formula C15H22FNO3S and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[[3-fluoro-5-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-fluoro-5-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 106722555 |
| Molecular Formula | C15H22FNO3S |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[[3-fluoro-5-(2-propan-2-ylsulfonylethoxy)phenyl]methyl]cyclopropanamine |
| SMILES | CC(C)S(=O)(=O)CCOc1cc(F)cc(CNC2CC2)c1 |
| InChI | InChI=1S/C15H22FNO3S/c1-11(2)21(18,19)6-5-20-15-8-12(7-13(16)9-15)10-17-14-3-4-14/h7-9,11,14,17H,3-6,10H2,1-2H3 |
| InChIKey | RVILJZURFJVNOO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |