2-(3,5-difluorophenyl)oxolane-3-carboxylic acid

C11H10F2O3 — CID 106534410

IUPAC2-(3,5-difluorophenyl)oxolane-3-carboxylic acid
SMILESO=C(O)C1CCOC1c1cc(F)cc(F)c1
InChIInChI=1S/C11H10F2O3/c12-7-3-6(4-8(13)5-7)10-9(11(14)15)1-2-16-10/h3-5,9-10H,1-2H2,(H,14,15)
InChIKeyNTSOTXKAUMIIKW-UHFFFAOYSA-N
MW228.19 g/mol
LogP2.13
Rot. Bonds2

About 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid

2-(3,5-difluorophenyl)oxolane-3-carboxylic acid (PubChem CID 106534410) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid.

Molecular Properties

Compound Name2-(3,5-difluorophenyl)oxolane-3-carboxylic acid
PubChem CID106534410
Molecular FormulaC11H10F2O3
Molecular Weight228.19 g/mol
Exact Mass228.06
IUPAC Name2-(3,5-difluorophenyl)oxolane-3-carboxylic acid
SMILESO=C(O)C1CCOC1c1cc(F)cc(F)c1
InChIInChI=1S/C11H10F2O3/c12-7-3-6(4-8(13)5-7)10-9(11(14)15)1-2-16-10/h3-5,9-10H,1-2H2,(H,14,15)
InChIKeyNTSOTXKAUMIIKW-UHFFFAOYSA-N
XLogP2.13
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.19
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid?
The IUPAC name of 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid (CID 106534410) is 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid.
What is the SMILES notation for 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid?
The canonical SMILES for 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid is O=C(O)C1CCOC1c1cc(F)cc(F)c1.
What is the InChIKey of 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid?
The InChIKey is NTSOTXKAUMIIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2O3/c12-7-3-6(4-8(13)5-7)10-9(11(14)15)1-2-16-10/h3-5,9-10H,1-2H2,(H,14,15).
What are the key properties of 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid?
2-(3,5-difluorophenyl)oxolane-3-carboxylic acid has a molecular weight of 228.19 g/mol, XLogP of 2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid is sourced from PubChem (CID 106534410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).