C11H10F2O3 — CID 106534410
2-(3,5-difluorophenyl)oxolane-3-carboxylic acid (PubChem CID 106534410) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid.
| Compound Name | 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106534410 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 2-(3,5-difluorophenyl)oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1CCOC1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H10F2O3/c12-7-3-6(4-8(13)5-7)10-9(11(14)15)1-2-16-10/h3-5,9-10H,1-2H2,(H,14,15) |
| InChIKey | NTSOTXKAUMIIKW-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |