About 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine
5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine (PubChem CID 106537763) has the molecular formula C13H12BrN5
and a molecular weight of 318.18 g/mol. Its IUPAC name is 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine |
| PubChem CID | 106537763 |
| Molecular Formula | C13H12BrN5 |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine |
| SMILES | Cn1cnnc1CNc1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C13H12BrN5/c1-19-8-17-18-12(19)7-16-13-10-3-2-4-11(14)9(10)5-6-15-13/h2-6,8H,7H2,1H3,(H,15,16) |
| InChIKey | WZCGMNLVSCFWHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine?
The IUPAC name of 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine (CID 106537763) is 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine.
What is the SMILES notation for 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine?
The canonical SMILES for 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine is Cn1cnnc1CNc1nccc2c(Br)cccc12.
What is the InChIKey of 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine?
The InChIKey is WZCGMNLVSCFWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrN5/c1-19-8-17-18-12(19)7-16-13-10-3-2-4-11(14)9(10)5-6-15-13/h2-6,8H,7H2,1H3,(H,15,16).
What are the key properties of 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine?
5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine has a molecular weight of 318.18 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]isoquinolin-1-amine is sourced from PubChem (CID 106537763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).