C16H11BrF2N2 — CID 106538164
5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine (PubChem CID 106538164) has the molecular formula C16H11BrF2N2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine.
| Compound Name | 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 106538164 |
| Molecular Formula | C16H11BrF2N2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine |
| SMILES | Fc1ccc(CNc2nccc3c(Br)cccc23)cc1F |
| InChI | InChI=1S/C16H11BrF2N2/c17-13-3-1-2-12-11(13)6-7-20-16(12)21-9-10-4-5-14(18)15(19)8-10/h1-8H,9H2,(H,20,21) |
| InChIKey | FIAKLGYBAOOECO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |