About 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine
5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine (PubChem CID 106538164) has the molecular formula C16H11BrF2N2
and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine |
| PubChem CID | 106538164 |
| Molecular Formula | C16H11BrF2N2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine |
| SMILES | Fc1ccc(CNc2nccc3c(Br)cccc23)cc1F |
| InChI | InChI=1S/C16H11BrF2N2/c17-13-3-1-2-12-11(13)6-7-20-16(12)21-9-10-4-5-14(18)15(19)8-10/h1-8H,9H2,(H,20,21) |
| InChIKey | FIAKLGYBAOOECO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine?
The IUPAC name of 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine (CID 106538164) is 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine.
What is the SMILES notation for 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine?
The canonical SMILES for 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine is Fc1ccc(CNc2nccc3c(Br)cccc23)cc1F.
What is the InChIKey of 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine?
The InChIKey is FIAKLGYBAOOECO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrF2N2/c17-13-3-1-2-12-11(13)6-7-20-16(12)21-9-10-4-5-14(18)15(19)8-10/h1-8H,9H2,(H,20,21).
What are the key properties of 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine?
5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine has a molecular weight of 349.18 g/mol, XLogP of 4.89, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(3,4-difluorophenyl)methyl]isoquinolin-1-amine is sourced from PubChem (CID 106538164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).