C17H14BrFN2 — CID 106537294
5-bromo-N-[2-(2-fluorophenyl)ethyl]isoquinolin-1-amine (PubChem CID 106537294) has the molecular formula C17H14BrFN2 and a molecular weight of 345.22 g/mol. Its IUPAC name is 5-bromo-N-[2-(2-fluorophenyl)ethyl]isoquinolin-1-amine.
| Compound Name | 5-bromo-N-[2-(2-fluorophenyl)ethyl]isoquinolin-1-amine |
|---|---|
| PubChem CID | 106537294 |
| Molecular Formula | C17H14BrFN2 |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 5-bromo-N-[2-(2-fluorophenyl)ethyl]isoquinolin-1-amine |
| SMILES | Fc1ccccc1CCNc1nccc2c(Br)cccc12 |
| InChI | InChI=1S/C17H14BrFN2/c18-15-6-3-5-14-13(15)9-11-21-17(14)20-10-8-12-4-1-2-7-16(12)19/h1-7,9,11H,8,10H2,(H,20,21) |
| InChIKey | RDEGAZAVKUTTOT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |