C17H22N2O — CID 106538850
N-(2,3-dimethylcyclopentyl)-5-methoxyisoquinolin-1-amine (PubChem CID 106538850) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)-5-methoxyisoquinolin-1-amine.
| Compound Name | N-(2,3-dimethylcyclopentyl)-5-methoxyisoquinolin-1-amine |
|---|---|
| PubChem CID | 106538850 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)-5-methoxyisoquinolin-1-amine |
| SMILES | COc1cccc2c(NC3CCC(C)C3C)nccc12 |
| InChI | InChI=1S/C17H22N2O/c1-11-7-8-15(12(11)2)19-17-14-5-4-6-16(20-3)13(14)9-10-18-17/h4-6,9-12,15H,7-8H2,1-3H3,(H,18,19) |
| InChIKey | HRBWXIHVNOZYFF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |