C16H20N2 — CID 64923219
N-(2,3-dimethylcyclopentyl)quinolin-4-amine (PubChem CID 64923219) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is N-(2,3-dimethylcyclopentyl)quinolin-4-amine.
| Compound Name | N-(2,3-dimethylcyclopentyl)quinolin-4-amine |
|---|---|
| PubChem CID | 64923219 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-(2,3-dimethylcyclopentyl)quinolin-4-amine |
| SMILES | CC1CCC(Nc2ccnc3ccccc23)C1C |
| InChI | InChI=1S/C16H20N2/c1-11-7-8-14(12(11)2)18-16-9-10-17-15-6-4-3-5-13(15)16/h3-6,9-12,14H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | BQMAGZDBMPKJON-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |