C11H8BrN5 — CID 106541716
1-(5-bromoisoquinolin-1-yl)-1,2,4-triazol-3-amine (PubChem CID 106541716) has the molecular formula C11H8BrN5 and a molecular weight of 290.12 g/mol. Its IUPAC name is 1-(5-bromoisoquinolin-1-yl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(5-bromoisoquinolin-1-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 106541716 |
| Molecular Formula | C11H8BrN5 |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 1-(5-bromoisoquinolin-1-yl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(-c2nccc3c(Br)cccc23)n1 |
| InChI | InChI=1S/C11H8BrN5/c12-9-3-1-2-8-7(9)4-5-14-10(8)17-6-15-11(13)16-17/h1-6H,(H2,13,16) |
| InChIKey | WPFSYTFIEQRCPA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |