C9H7N5O — CID 106535472
1-furo[3,2-c]pyridin-4-yl-1,2,4-triazol-3-amine (PubChem CID 106535472) has the molecular formula C9H7N5O and a molecular weight of 201.19 g/mol. Its IUPAC name is 1-furo[3,2-c]pyridin-4-yl-1,2,4-triazol-3-amine.
| Compound Name | 1-furo[3,2-c]pyridin-4-yl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 106535472 |
| Molecular Formula | C9H7N5O |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 1-furo[3,2-c]pyridin-4-yl-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(-c2nccc3occc23)n1 |
| InChI | InChI=1S/C9H7N5O/c10-9-12-5-14(13-9)8-6-2-4-15-7(6)1-3-11-8/h1-5H,(H2,10,13) |
| InChIKey | BLNKZYFPTILDPQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |